C16H21N3O3 — CID 8989325
N-butyl-N'-[(Z)-(4-prop-2-enoxyphenyl)methylideneamino]oxamide (PubChem CID 8989325) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-butyl-N'-[(Z)-(4-prop-2-enoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-butyl-N'-[(Z)-(4-prop-2-enoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 8989325 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-butyl-N'-[(Z)-(4-prop-2-enoxyphenyl)methylideneamino]oxamide |
| SMILES | C=CCOc1ccc(/C=N\NC(=O)C(=O)NCCCC)cc1 |
| InChI | InChI=1S/C16H21N3O3/c1-3-5-10-17-15(20)16(21)19-18-12-13-6-8-14(9-7-13)22-11-4-2/h4,6-9,12H,2-3,5,10-11H2,1H3,(H,17,20)(H,19,21)/b18-12- |
| InChIKey | DAGIVULHRTUPHQ-PDGQHHTCSA-N |
| XLogP | 1.62 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|