C18H25N3O4 — CID 8989348
N-(3-propan-2-yloxypropyl)-N'-[(Z)-(4-prop-2-enoxyphenyl)methylideneamino]oxamide (PubChem CID 8989348) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-(3-propan-2-yloxypropyl)-N'-[(Z)-(4-prop-2-enoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(3-propan-2-yloxypropyl)-N'-[(Z)-(4-prop-2-enoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 8989348 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-(3-propan-2-yloxypropyl)-N'-[(Z)-(4-prop-2-enoxyphenyl)methylideneamino]oxamide |
| SMILES | C=CCOc1ccc(/C=N\NC(=O)C(=O)NCCCOC(C)C)cc1 |
| InChI | InChI=1S/C18H25N3O4/c1-4-11-25-16-8-6-15(7-9-16)13-20-21-18(23)17(22)19-10-5-12-24-14(2)3/h4,6-9,13-14H,1,5,10-12H2,2-3H3,(H,19,22)(H,21,23)/b20-13- |
| InChIKey | HRUUDLVBMIXDMR-MOSHPQCFSA-N |
| XLogP | 1.63 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|