C12H14N2O3 — CID 5333365
2-hydroxy-N-[(E)-(4-prop-2-enoxyphenyl)methylideneamino]acetamide (PubChem CID 5333365) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-(4-prop-2-enoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-hydroxy-N-[(E)-(4-prop-2-enoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5333365 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-hydroxy-N-[(E)-(4-prop-2-enoxyphenyl)methylideneamino]acetamide |
| SMILES | C=CCOc1ccc(/C=N/NC(=O)CO)cc1 |
| InChI | InChI=1S/C12H14N2O3/c1-2-7-17-11-5-3-10(4-6-11)8-13-14-12(16)9-15/h2-6,8,15H,1,7,9H2,(H,14,16)/b13-8+ |
| InChIKey | ZNZISQPUHOTWIY-MDWZMJQESA-N |
| XLogP | 0.69 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|