C23H26Cl2N4O5 — CID 126266800
N'-[(Z)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide (PubChem CID 126266800) has the molecular formula C23H26Cl2N4O5 and a molecular weight of 509.39 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide |
|---|---|
| PubChem CID | 126266800 |
| Molecular Formula | C23H26Cl2N4O5 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | N'-[(Z)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide |
| SMILES | CC(C)OCCCNC(=O)C(=O)N/N=C\c1ccc(OCC(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C23H26Cl2N4O5/c1-15(2)33-11-3-10-26-22(31)23(32)29-27-13-16-4-7-18(8-5-16)34-14-21(30)28-17-6-9-19(24)20(25)12-17/h4-9,12-13,15H,3,10-11,14H2,1-2H3,(H,26,31)(H,28,30)(H,29,32)/b27-13- |
| InChIKey | SYWGOPWINDRCTM-WKIKZPBSSA-N |
| XLogP | 3.39 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|