C20H18Cl2N4O4 — CID 6877114
N'-[(E)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-prop-2-enyloxamide (PubChem CID 6877114) has the molecular formula C20H18Cl2N4O4 and a molecular weight of 449.29 g/mol. Its IUPAC name is N'-[(E)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-prop-2-enyloxamide.
| Compound Name | N'-[(E)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 6877114 |
| Molecular Formula | C20H18Cl2N4O4 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | N'-[(E)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)N/N=C/c1ccc(OCC(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H18Cl2N4O4/c1-2-9-23-19(28)20(29)26-24-11-13-3-6-15(7-4-13)30-12-18(27)25-14-5-8-16(21)17(22)10-14/h2-8,10-11H,1,9,12H2,(H,23,28)(H,25,27)(H,26,29)/b24-11+ |
| InChIKey | MBSNEFVMCNNCEC-BHGWPJFGSA-N |
| XLogP | 2.76 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|