C22H22Cl2N4O5 — CID 126166268
N'-[(Z)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-prop-2-enyloxamide (PubChem CID 126166268) has the molecular formula C22H22Cl2N4O5 and a molecular weight of 493.35 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-prop-2-enyloxamide.
| Compound Name | N'-[(Z)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 126166268 |
| Molecular Formula | C22H22Cl2N4O5 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | N'-[(Z)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)N/N=C\c1ccc(OCC(=O)Nc2ccc(Cl)c(Cl)c2)c(OCC)c1 |
| InChI | InChI=1S/C22H22Cl2N4O5/c1-3-9-25-21(30)22(31)28-26-12-14-5-8-18(19(10-14)32-4-2)33-13-20(29)27-15-6-7-16(23)17(24)11-15/h3,5-8,10-12H,1,4,9,13H2,2H3,(H,25,30)(H,27,29)(H,28,31)/b26-12- |
| InChIKey | OSRINHVZBSIUOQ-ZRGSRPPYSA-N |
| XLogP | 3.16 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|