C23H27ClN4O5 — CID 126181022
N'-[(Z)-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-methylpropyl)oxamide (PubChem CID 126181022) has the molecular formula C23H27ClN4O5 and a molecular weight of 474.95 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-methylpropyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 126181022 |
| Molecular Formula | C23H27ClN4O5 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N'-[(Z)-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-methylpropyl)oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCC(C)C)ccc1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H27ClN4O5/c1-4-32-20-11-16(13-26-28-23(31)22(30)25-12-15(2)3)5-10-19(20)33-14-21(29)27-18-8-6-17(24)7-9-18/h5-11,13,15H,4,12,14H2,1-3H3,(H,25,30)(H,27,29)(H,28,31)/b26-13- |
| InChIKey | OLEVZBSDPZRSBA-ZMFRSBBQSA-N |
| XLogP | 2.98 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|