C22H25BrN4O5 — CID 4316310
N'-[[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(2-methylpropyl)oxamide (PubChem CID 4316310) has the molecular formula C22H25BrN4O5 and a molecular weight of 505.37 g/mol. Its IUPAC name is N'-[[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(2-methylpropyl)oxamide.
| Compound Name | N'-[[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 4316310 |
| Molecular Formula | C22H25BrN4O5 |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | N'-[[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(2-methylpropyl)oxamide |
| SMILES | COc1cc(C=NNC(=O)C(=O)NCC(C)C)ccc1OCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H25BrN4O5/c1-14(2)11-24-21(29)22(30)27-25-12-15-4-9-18(19(10-15)31-3)32-13-20(28)26-17-7-5-16(23)6-8-17/h4-10,12,14H,11,13H2,1-3H3,(H,24,29)(H,26,28)(H,27,30) |
| InChIKey | UCYVGRIYABLVGW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|