C23H25BrN4O6 — CID 126256191
N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide (PubChem CID 126256191) has the molecular formula C23H25BrN4O6 and a molecular weight of 533.38 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 126256191 |
| Molecular Formula | C23H25BrN4O6 |
| Molecular Weight | 533.38 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NC[C@H]2CCCO2)ccc1OCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H25BrN4O6/c1-32-20-11-15(12-26-28-23(31)22(30)25-13-18-3-2-10-33-18)4-9-19(20)34-14-21(29)27-17-7-5-16(24)6-8-17/h4-9,11-12,18H,2-3,10,13-14H2,1H3,(H,25,30)(H,27,29)(H,28,31)/b26-12-/t18-/m1/s1 |
| InChIKey | KYMBAKJCSQXPSR-FMOWSKJYSA-N |
| XLogP | 2.22 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|