C25H30N4O6 — CID 126273337
N'-[(Z)-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide (PubChem CID 126273337) has the molecular formula C25H30N4O6 and a molecular weight of 482.54 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(Z)-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 126273337 |
| Molecular Formula | C25H30N4O6 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | N'-[(Z)-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NC[C@@H]2CCCO2)ccc1OCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C25H30N4O6/c1-16-6-8-20(17(2)11-16)28-23(30)15-35-21-9-7-18(12-22(21)33-3)13-27-29-25(32)24(31)26-14-19-5-4-10-34-19/h6-9,11-13,19H,4-5,10,14-15H2,1-3H3,(H,26,31)(H,28,30)(H,29,32)/b27-13-/t19-/m0/s1 |
| InChIKey | SZWITBYJXHLULE-BYKMWVPLSA-N |
| XLogP | 2.07 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|