C22H24Cl2N4O5 — CID 126162291
N'-[(Z)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-propan-2-yloxamide (PubChem CID 126162291) has the molecular formula C22H24Cl2N4O5 and a molecular weight of 495.36 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-propan-2-yloxamide.
| Compound Name | N'-[(Z)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-propan-2-yloxamide |
|---|---|
| PubChem CID | 126162291 |
| Molecular Formula | C22H24Cl2N4O5 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | N'-[(Z)-[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-propan-2-yloxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NC(C)C)ccc1OCC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H24Cl2N4O5/c1-4-32-19-9-14(11-25-28-22(31)21(30)26-13(2)3)5-8-18(19)33-12-20(29)27-15-6-7-16(23)17(24)10-15/h5-11,13H,4,12H2,1-3H3,(H,26,30)(H,27,29)(H,28,31)/b25-11- |
| InChIKey | JWYGSUOQDIVMKZ-GATIEOLUSA-N |
| XLogP | 3.38 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|