C24H17ClF4N4O4 — CID 126008645
N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126008645) has the molecular formula C24H17ClF4N4O4 and a molecular weight of 536.87 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126008645 |
| Molecular Formula | C24H17ClF4N4O4 |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | O=C(COc1ccc(/C=N\NC(=O)C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H17ClF4N4O4/c25-20-10-7-17(11-19(20)24(27,28)29)32-22(35)23(36)33-30-12-14-1-8-18(9-2-14)37-13-21(34)31-16-5-3-15(26)4-6-16/h1-12H,13H2,(H,31,34)(H,32,35)(H,33,36)/b30-12- |
| InChIKey | SCIPDRNDBLAPMJ-FTCYSYDXSA-N |
| XLogP | 4.60 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|