C23H17Cl2FN4O4 — CID 126268511
N'-[(Z)-[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-fluorophenyl)oxamide (PubChem CID 126268511) has the molecular formula C23H17Cl2FN4O4 and a molecular weight of 503.32 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-fluorophenyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 126268511 |
| Molecular Formula | C23H17Cl2FN4O4 |
| Molecular Weight | 503.32 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | N'-[(Z)-[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-fluorophenyl)oxamide |
| SMILES | O=C(COc1ccc(/C=N\NC(=O)C(=O)Nc2ccc(F)cc2)cc1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H17Cl2FN4O4/c24-15-9-16(25)11-19(10-15)28-21(31)13-34-20-7-1-14(2-8-20)12-27-30-23(33)22(32)29-18-5-3-17(26)4-6-18/h1-12H,13H2,(H,28,31)(H,29,32)(H,30,33)/b27-12- |
| InChIKey | GWTRZVJOMKNIDS-PPDIBHTLSA-N |
| XLogP | 4.24 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|