C18H14ClF3N4O3 — CID 25251109
N'-[(E)-(4-acetamidophenyl)methylideneamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide (PubChem CID 25251109) has the molecular formula C18H14ClF3N4O3 and a molecular weight of 426.78 g/mol. Its IUPAC name is N'-[(E)-(4-acetamidophenyl)methylideneamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-[(E)-(4-acetamidophenyl)methylideneamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 25251109 |
| Molecular Formula | C18H14ClF3N4O3 |
| Molecular Weight | 426.78 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | N'-[(E)-(4-acetamidophenyl)methylideneamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide |
| SMILES | CC(=O)Nc1ccc(/C=N/NC(=O)C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H14ClF3N4O3/c1-10(27)24-12-4-2-11(3-5-12)9-23-26-17(29)16(28)25-13-6-7-15(19)14(8-13)18(20,21)22/h2-9H,1H3,(H,24,27)(H,25,28)(H,26,29)/b23-9+ |
| InChIKey | FXIBXMFEZPMSAW-NUGSKGIGSA-N |
| XLogP | 3.41 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|