C16H11ClF3N3O4 — CID 135647190
N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[(E)-(3,4-dihydroxyphenyl)methylideneamino]oxamide (PubChem CID 135647190) has the molecular formula C16H11ClF3N3O4 and a molecular weight of 401.73 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[(E)-(3,4-dihydroxyphenyl)methylideneamino]oxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[(E)-(3,4-dihydroxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 135647190 |
| Molecular Formula | C16H11ClF3N3O4 |
| Molecular Weight | 401.73 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[(E)-(3,4-dihydroxyphenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C/c1ccc(O)c(O)c1)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11ClF3N3O4/c17-11-3-2-9(6-10(11)16(18,19)20)22-14(26)15(27)23-21-7-8-1-4-12(24)13(25)5-8/h1-7,24-25H,(H,22,26)(H,23,27)/b21-7+ |
| InChIKey | WOWNSEQWMVSKPT-QPSGOUHRSA-N |
| XLogP | 2.86 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|