C17H13ClF3N3O4 — CID 135679282
N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]oxamide (PubChem CID 135679282) has the molecular formula C17H13ClF3N3O4 and a molecular weight of 415.76 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 135679282 |
| Molecular Formula | C17H13ClF3N3O4 |
| Molecular Weight | 415.76 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1cc(/C=N/NC(=O)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)ccc1O |
| InChI | InChI=1S/C17H13ClF3N3O4/c1-28-14-6-9(2-5-13(14)25)8-22-24-16(27)15(26)23-12-7-10(17(19,20)21)3-4-11(12)18/h2-8,25H,1H3,(H,23,26)(H,24,27)/b22-8+ |
| InChIKey | CRMQKJSJSDFDPG-GZIVZEMBSA-N |
| XLogP | 3.16 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|