C23H19ClN4O5 — CID 5049729
N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(4-hydroxy-3-methoxyphenyl)methylideneamino]oxamide (PubChem CID 5049729) has the molecular formula C23H19ClN4O5 and a molecular weight of 466.88 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(4-hydroxy-3-methoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(4-hydroxy-3-methoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 5049729 |
| Molecular Formula | C23H19ClN4O5 |
| Molecular Weight | 466.88 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(4-hydroxy-3-methoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1cc(C=NNC(=O)C(=O)Nc2ccccc2C(=O)Nc2ccc(Cl)cc2)ccc1O |
| InChI | InChI=1S/C23H19ClN4O5/c1-33-20-12-14(6-11-19(20)29)13-25-28-23(32)22(31)27-18-5-3-2-4-17(18)21(30)26-16-9-7-15(24)8-10-16/h2-13,29H,1H3,(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | BBLYTCVBHKEWAQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.88 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|