C25H23BrN4O6 — CID 4143510
N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(3,4,5-trimethoxyphenyl)methylideneamino]oxamide (PubChem CID 4143510) has the molecular formula C25H23BrN4O6 and a molecular weight of 555.39 g/mol. Its IUPAC name is N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(3,4,5-trimethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(3,4,5-trimethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 4143510 |
| Molecular Formula | C25H23BrN4O6 |
| Molecular Weight | 555.39 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(3,4,5-trimethoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1cc(C=NNC(=O)C(=O)Nc2ccccc2C(=O)Nc2ccc(Br)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H23BrN4O6/c1-34-20-12-15(13-21(35-2)22(20)36-3)14-27-30-25(33)24(32)29-19-7-5-4-6-18(19)23(31)28-17-10-8-16(26)9-11-17/h4-14H,1-3H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | ADYYPIRUIBVLEW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|