C25H21BrN4O4 — CID 6153387
N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide (PubChem CID 6153387) has the molecular formula C25H21BrN4O4 and a molecular weight of 521.37 g/mol. Its IUPAC name is N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 6153387 |
| Molecular Formula | C25H21BrN4O4 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]oxamide |
| SMILES | C=CCOc1cccc(/C=N\NC(=O)C(=O)Nc2ccccc2C(=O)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C25H21BrN4O4/c1-2-14-34-20-7-5-6-17(15-20)16-27-30-25(33)24(32)29-22-9-4-3-8-21(22)23(31)28-19-12-10-18(26)11-13-19/h2-13,15-16H,1,14H2,(H,28,31)(H,29,32)(H,30,33)/b27-16- |
| InChIKey | DECFLCZZRCPIJJ-YUMHPJSZSA-N |
| XLogP | 4.36 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|