C29H22Br2N4O4 — CID 4583774
N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]oxamide (PubChem CID 4583774) has the molecular formula C29H22Br2N4O4 and a molecular weight of 650.33 g/mol. Its IUPAC name is N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 4583774 |
| Molecular Formula | C29H22Br2N4O4 |
| Molecular Weight | 650.33 g/mol |
| Exact Mass | 648.00 |
| IUPAC Name | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1ccccc1OCc1ccc(Br)cc1)C(=O)Nc1ccccc1C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C29H22Br2N4O4/c30-21-11-9-19(10-12-21)18-39-26-8-4-1-5-20(26)17-32-35-29(38)28(37)34-25-7-3-2-6-24(25)27(36)33-23-15-13-22(31)14-16-23/h1-17H,18H2,(H,33,36)(H,34,37)(H,35,38) |
| InChIKey | YQWJCQFNAZEOCA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.33 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|