C26H21N3O3 — CID 51060568
N-naphthalen-1-yl-N'-[(E)-(2-phenylmethoxyphenyl)methylideneamino]oxamide (PubChem CID 51060568) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-naphthalen-1-yl-N'-[(E)-(2-phenylmethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-naphthalen-1-yl-N'-[(E)-(2-phenylmethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 51060568 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-naphthalen-1-yl-N'-[(E)-(2-phenylmethoxyphenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C/c1ccccc1OCc1ccccc1)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C26H21N3O3/c30-25(28-23-15-8-13-20-11-4-6-14-22(20)23)26(31)29-27-17-21-12-5-7-16-24(21)32-18-19-9-2-1-3-10-19/h1-17H,18H2,(H,28,30)(H,29,31)/b27-17+ |
| InChIKey | AHMZSTKPGCMFLP-WPWMEQJKSA-N |
| XLogP | 4.51 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|