C33H24BrFN4O4 — CID 6139460
N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]oxamide (PubChem CID 6139460) has the molecular formula C33H24BrFN4O4 and a molecular weight of 639.48 g/mol. Its IUPAC name is N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]oxamide.
| Compound Name | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 6139460 |
| Molecular Formula | C33H24BrFN4O4 |
| Molecular Weight | 639.48 g/mol |
| Exact Mass | 638.10 |
| IUPAC Name | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1c(OCc2ccc(F)cc2)ccc2ccccc12)C(=O)Nc1ccccc1C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C33H24BrFN4O4/c34-23-12-16-25(17-13-23)37-31(40)27-7-3-4-8-29(27)38-32(41)33(42)39-36-19-28-26-6-2-1-5-22(26)11-18-30(28)43-20-21-9-14-24(35)15-10-21/h1-19H,20H2,(H,37,40)(H,38,41)(H,39,42)/b36-19- |
| InChIKey | HMSIHHMOKKAPOB-WBIBEUCMSA-N |
| XLogP | 6.66 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.48 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|