C32H25N3O4 — CID 25251113
N-(4-phenoxyphenyl)-N'-[(E)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]oxamide (PubChem CID 25251113) has the molecular formula C32H25N3O4 and a molecular weight of 515.57 g/mol. Its IUPAC name is N-(4-phenoxyphenyl)-N'-[(E)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]oxamide.
| Compound Name | N-(4-phenoxyphenyl)-N'-[(E)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 25251113 |
| Molecular Formula | C32H25N3O4 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | N-(4-phenoxyphenyl)-N'-[(E)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C/c1c(OCc2ccccc2)ccc2ccccc12)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C32H25N3O4/c36-31(34-25-16-18-27(19-17-25)39-26-12-5-2-6-13-26)32(37)35-33-21-29-28-14-8-7-11-24(28)15-20-30(29)38-22-23-9-3-1-4-10-23/h1-21H,22H2,(H,34,36)(H,35,37)/b33-21+ |
| InChIKey | AFQAEWVZNXZPRH-QNKGDIEWSA-N |
| XLogP | 6.30 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|