C32H24BrN3O4 — CID 5195606
N'-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide (PubChem CID 5195606) has the molecular formula C32H24BrN3O4 and a molecular weight of 594.47 g/mol. Its IUPAC name is N'-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide.
| Compound Name | N'-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide |
|---|---|
| PubChem CID | 5195606 |
| Molecular Formula | C32H24BrN3O4 |
| Molecular Weight | 594.47 g/mol |
| Exact Mass | 593.10 |
| IUPAC Name | N'-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide |
| SMILES | O=C(NN=Cc1c(OCc2cccc(Br)c2)ccc2ccccc12)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C32H24BrN3O4/c33-24-9-6-7-22(19-24)21-39-30-18-13-23-8-4-5-12-28(23)29(30)20-34-36-32(38)31(37)35-25-14-16-27(17-15-25)40-26-10-2-1-3-11-26/h1-20H,21H2,(H,35,37)(H,36,38) |
| InChIKey | WINABIOZHPUQON-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.47 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|