C26H22BrN3O4S — CID 4599921
2-(benzenesulfonamido)-N-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide (PubChem CID 4599921) has the molecular formula C26H22BrN3O4S and a molecular weight of 552.45 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4599921 |
| Molecular Formula | C26H22BrN3O4S |
| Molecular Weight | 552.45 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)NN=Cc1c(OCc2cccc(Br)c2)ccc2ccccc12 |
| InChI | InChI=1S/C26H22BrN3O4S/c27-21-9-6-7-19(15-21)18-34-25-14-13-20-8-4-5-12-23(20)24(25)16-28-30-26(31)17-29-35(32,33)22-10-2-1-3-11-22/h1-16,29H,17-18H2,(H,30,31) |
| InChIKey | ZERXCXITHRNWOP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|