C25H21BrN2O3S — CID 6114794
N-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 6114794) has the molecular formula C25H21BrN2O3S and a molecular weight of 509.43 g/mol. Its IUPAC name is N-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 6114794 |
| Molecular Formula | C25H21BrN2O3S |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | N-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C\c2c(OCc3cccc(Br)c3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H21BrN2O3S/c1-18-9-12-22(13-10-18)32(29,30)28-27-16-24-23-8-3-2-6-20(23)11-14-25(24)31-17-19-5-4-7-21(26)15-19/h2-16,28H,17H2,1H3/b27-16- |
| InChIKey | XHEHBZZUNKVZNU-YUMHPJSZSA-N |
| XLogP | 5.80 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|