C25H18BrClN2O2 — CID 4108079
N-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-chlorobenzamide (PubChem CID 4108079) has the molecular formula C25H18BrClN2O2 and a molecular weight of 493.79 g/mol. Its IUPAC name is N-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-chlorobenzamide.
| Compound Name | N-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-chlorobenzamide |
|---|---|
| PubChem CID | 4108079 |
| Molecular Formula | C25H18BrClN2O2 |
| Molecular Weight | 493.79 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | N-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-chlorobenzamide |
| SMILES | O=C(NN=Cc1c(OCc2cccc(Br)c2)ccc2ccccc12)c1ccccc1Cl |
| InChI | InChI=1S/C25H18BrClN2O2/c26-19-8-5-6-17(14-19)16-31-24-13-12-18-7-1-2-9-20(18)22(24)15-28-29-25(30)21-10-3-4-11-23(21)27/h1-15H,16H2,(H,29,30) |
| InChIKey | CTTRVCCIVUUUHL-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.79 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|