C25H19BrN2O2 — CID 29147296
2-bromo-N-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]benzamide (PubChem CID 29147296) has the molecular formula C25H19BrN2O2 and a molecular weight of 459.34 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 29147296 |
| Molecular Formula | C25H19BrN2O2 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 2-bromo-N-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1c(OCc2ccccc2)ccc2ccccc12)c1ccccc1Br |
| InChI | InChI=1S/C25H19BrN2O2/c26-23-13-7-6-12-21(23)25(29)28-27-16-22-20-11-5-4-10-19(20)14-15-24(22)30-17-18-8-2-1-3-9-18/h1-16H,17H2,(H,28,29)/b27-16- |
| InChIKey | ITLVISXHCUJLOM-YUMHPJSZSA-N |
| XLogP | 5.95 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|