C28H22N2O3 — CID 19657881
2-phenylmethoxy-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]benzamide (PubChem CID 19657881) has the molecular formula C28H22N2O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-phenylmethoxy-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]benzamide.
| Compound Name | 2-phenylmethoxy-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 19657881 |
| Molecular Formula | C28H22N2O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-phenylmethoxy-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]benzamide |
| SMILES | C#CCOc1ccc2ccccc2c1/C=N\NC(=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H22N2O3/c1-2-18-32-27-17-16-22-12-6-7-13-23(22)25(27)19-29-30-28(31)24-14-8-9-15-26(24)33-20-21-10-4-3-5-11-21/h1,3-17,19H,18,20H2,(H,30,31)/b29-19- |
| InChIKey | OBLQPDGKQKMSRJ-CEUNXORHSA-N |
| XLogP | 5.19 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|