C21H15N3O5 — CID 40565670
2-hydroxy-5-nitro-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]benzamide (PubChem CID 40565670) has the molecular formula C21H15N3O5 and a molecular weight of 389.37 g/mol. Its IUPAC name is 2-hydroxy-5-nitro-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]benzamide.
| Compound Name | 2-hydroxy-5-nitro-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 40565670 |
| Molecular Formula | C21H15N3O5 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-hydroxy-5-nitro-N-[(Z)-(2-prop-2-ynoxynaphthalen-1-yl)methylideneamino]benzamide |
| SMILES | C#CCOc1ccc2ccccc2c1/C=N\NC(=O)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C21H15N3O5/c1-2-11-29-20-10-7-14-5-3-4-6-16(14)18(20)13-22-23-21(26)17-12-15(24(27)28)8-9-19(17)25/h1,3-10,12-13,25H,11H2,(H,23,26)/b22-13- |
| InChIKey | FAUSWTRAEFOJKU-XKZIYDEJSA-N |
| XLogP | 3.23 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|