C14H10N4O7 — CID 3358963
2-hydroxy-N-[(2-hydroxy-5-nitrophenyl)methylideneamino]-5-nitrobenzamide (PubChem CID 3358963) has the molecular formula C14H10N4O7 and a molecular weight of 346.26 g/mol. Its IUPAC name is 2-hydroxy-N-[(2-hydroxy-5-nitrophenyl)methylideneamino]-5-nitrobenzamide.
| Compound Name | 2-hydroxy-N-[(2-hydroxy-5-nitrophenyl)methylideneamino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 3358963 |
| Molecular Formula | C14H10N4O7 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2-hydroxy-N-[(2-hydroxy-5-nitrophenyl)methylideneamino]-5-nitrobenzamide |
| SMILES | O=C(NN=Cc1cc([N+](=O)[O-])ccc1O)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C14H10N4O7/c19-12-3-1-9(17(22)23)5-8(12)7-15-16-14(21)11-6-10(18(24)25)2-4-13(11)20/h1-7,19-20H,(H,16,21) |
| InChIKey | MQUVCJMDRGNJEF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 168.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|