C15H10N4O8 — CID 126052078
2-hydroxy-5-nitro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide (PubChem CID 126052078) has the molecular formula C15H10N4O8 and a molecular weight of 374.27 g/mol. Its IUPAC name is 2-hydroxy-5-nitro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide.
| Compound Name | 2-hydroxy-5-nitro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126052078 |
| Molecular Formula | C15H10N4O8 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-hydroxy-5-nitro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1cc2c(cc1[N+](=O)[O-])OCO2)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C15H10N4O8/c20-12-2-1-9(18(22)23)4-10(12)15(21)17-16-6-8-3-13-14(27-7-26-13)5-11(8)19(24)25/h1-6,20H,7H2,(H,17,21)/b16-6- |
| InChIKey | GYQGKRFWKFWXMG-SOFYXZRVSA-N |
| XLogP | 1.70 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|