C12H9N5O5 — CID 5404816
N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 5404816) has the molecular formula C12H9N5O5 and a molecular weight of 303.23 g/mol. Its IUPAC name is N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 5404816 |
| Molecular Formula | C12H9N5O5 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C\c1cc2c(cc1[N+](=O)[O-])OCO2)c1ccn[nH]1 |
| InChI | InChI=1S/C12H9N5O5/c18-12(8-1-2-13-15-8)16-14-5-7-3-10-11(22-6-21-10)4-9(7)17(19)20/h1-5H,6H2,(H,13,15)(H,16,18)/b14-5- |
| InChIKey | DHUIDJDCGJPBDQ-RZNTYIFUSA-N |
| XLogP | 0.81 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|