C17H10ClN3O6 — CID 126022966
5-chloro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126022966) has the molecular formula C17H10ClN3O6 and a molecular weight of 387.74 g/mol. Its IUPAC name is 5-chloro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126022966 |
| Molecular Formula | C17H10ClN3O6 |
| Molecular Weight | 387.74 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 5-chloro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1cc2c(cc1[N+](=O)[O-])OCO2)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C17H10ClN3O6/c18-11-1-2-13-9(3-11)4-16(27-13)17(22)20-19-7-10-5-14-15(26-8-25-14)6-12(10)21(23)24/h1-7H,8H2,(H,20,22)/b19-7- |
| InChIKey | RWYSJLHDWSCFQL-GXHLCREISA-N |
| XLogP | 3.49 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.74 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|