C14H10ClN3O6S — CID 1349898
4-chloro-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzenesulfonamide (PubChem CID 1349898) has the molecular formula C14H10ClN3O6S and a molecular weight of 383.77 g/mol. Its IUPAC name is 4-chloro-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 1349898 |
| Molecular Formula | C14H10ClN3O6S |
| Molecular Weight | 383.77 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 4-chloro-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc2c(cc1C=NNS(=O)(=O)c1ccc(Cl)cc1)OCO2 |
| InChI | InChI=1S/C14H10ClN3O6S/c15-10-1-3-11(4-2-10)25(21,22)17-16-7-9-5-13-14(24-8-23-13)6-12(9)18(19)20/h1-7,17H,8H2 |
| InChIKey | IVSVWRYYZMJUCB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.77 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|