C14H11ClN2O4S — CID 696656
N-(1,3-benzodioxol-5-ylmethylideneamino)-4-chlorobenzenesulfonamide (PubChem CID 696656) has the molecular formula C14H11ClN2O4S and a molecular weight of 338.77 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethylideneamino)-4-chlorobenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 696656 |
| Molecular Formula | C14H11ClN2O4S |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(NN=Cc1ccc2c(c1)OCO2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H11ClN2O4S/c15-11-2-4-12(5-3-11)22(18,19)17-16-8-10-1-6-13-14(7-10)21-9-20-13/h1-8,17H,9H2 |
| InChIKey | BPIOJCNNAOQBHP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|