C18H16ClN3O4 — CID 5187406
N-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-2-(4-chlorophenyl)acetamide (PubChem CID 5187406) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is N-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 5187406 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCC(=O)NN=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H16ClN3O4/c19-14-4-1-12(2-5-14)8-17(23)20-10-18(24)22-21-9-13-3-6-15-16(7-13)26-11-25-15/h1-7,9H,8,10-11H2,(H,20,23)(H,22,24) |
| InChIKey | TYLYXSJRTBZHAT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|