C15H11ClN2O3 — CID 5404525
N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-chlorobenzamide (PubChem CID 5404525) has the molecular formula C15H11ClN2O3 and a molecular weight of 302.72 g/mol. Its IUPAC name is N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-chlorobenzamide.
| Compound Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-chlorobenzamide |
|---|---|
| PubChem CID | 5404525 |
| Molecular Formula | C15H11ClN2O3 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-chlorobenzamide |
| SMILES | O=C(N/N=C\c1ccc2c(c1)OCO2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClN2O3/c16-12-4-2-11(3-5-12)15(19)18-17-8-10-1-6-13-14(7-10)21-9-20-13/h1-8H,9H2,(H,18,19)/b17-8- |
| InChIKey | RPVKNDDIHSBYPA-IUXPMGMMSA-N |
| XLogP | 2.83 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|