C15H10BrClN2O3 — CID 6034378
N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-chlorobenzamide (PubChem CID 6034378) has the molecular formula C15H10BrClN2O3 and a molecular weight of 381.61 g/mol. Its IUPAC name is N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-chlorobenzamide.
| Compound Name | N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-chlorobenzamide |
|---|---|
| PubChem CID | 6034378 |
| Molecular Formula | C15H10BrClN2O3 |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-chlorobenzamide |
| SMILES | O=C(N/N=C\c1cc2c(cc1Br)OCO2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10BrClN2O3/c16-12-6-14-13(21-8-22-14)5-10(12)7-18-19-15(20)9-1-3-11(17)4-2-9/h1-7H,8H2,(H,19,20)/b18-7- |
| InChIKey | SWIKZPJDRYFUOI-WSVATBPTSA-N |
| XLogP | 3.60 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|