C16H12BrClN2O4 — CID 1368198
N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(3-chlorophenoxy)acetamide (PubChem CID 1368198) has the molecular formula C16H12BrClN2O4 and a molecular weight of 411.64 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(3-chlorophenoxy)acetamide.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(3-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 1368198 |
| Molecular Formula | C16H12BrClN2O4 |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(3-chlorophenoxy)acetamide |
| SMILES | O=C(COc1cccc(Cl)c1)NN=Cc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C16H12BrClN2O4/c17-13-6-15-14(23-9-24-15)4-10(13)7-19-20-16(21)8-22-12-3-1-2-11(18)5-12/h1-7H,8-9H2,(H,20,21) |
| InChIKey | DBJYNSBQVANVDP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|