C17H14BrClN2O4 — CID 6058613
2-(2-bromo-4-methylphenoxy)-N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]acetamide (PubChem CID 6058613) has the molecular formula C17H14BrClN2O4 and a molecular weight of 425.67 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6058613 |
| Molecular Formula | C17H14BrClN2O4 |
| Molecular Weight | 425.67 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
| SMILES | Cc1ccc(OCC(=O)N/N=C\c2cc3c(cc2Cl)OCO3)c(Br)c1 |
| InChI | InChI=1S/C17H14BrClN2O4/c1-10-2-3-14(12(18)4-10)23-8-17(22)21-20-7-11-5-15-16(6-13(11)19)25-9-24-15/h2-7H,8-9H2,1H3,(H,21,22)/b20-7- |
| InChIKey | ZNTQGZFYXLMEJM-SCDVKCJHSA-N |
| XLogP | 3.67 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.67 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|