C17H13ClN2O5 — CID 126055349
2-(1,3-benzodioxol-5-yl)-N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]acetamide (PubChem CID 126055349) has the molecular formula C17H13ClN2O5 and a molecular weight of 360.75 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126055349 |
| Molecular Formula | C17H13ClN2O5 |
| Molecular Weight | 360.75 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N/N=C\c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C17H13ClN2O5/c18-12-6-16-15(24-9-25-16)5-11(12)7-19-20-17(21)4-10-1-2-13-14(3-10)23-8-22-13/h1-3,5-7H,4,8-9H2,(H,20,21)/b19-7- |
| InChIKey | VBVYBGRFLSUZOG-GXHLCREISA-N |
| XLogP | 2.49 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.75 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|