C16H13ClFN3O3 — CID 905701
N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-(4-fluoroanilino)acetamide (PubChem CID 905701) has the molecular formula C16H13ClFN3O3 and a molecular weight of 349.75 g/mol. Its IUPAC name is N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-(4-fluoroanilino)acetamide.
| Compound Name | N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-(4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 905701 |
| Molecular Formula | C16H13ClFN3O3 |
| Molecular Weight | 349.75 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-(4-fluoroanilino)acetamide |
| SMILES | O=C(CNc1ccc(F)cc1)NN=Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C16H13ClFN3O3/c17-13-6-15-14(23-9-24-15)5-10(13)7-20-21-16(22)8-19-12-3-1-11(18)2-4-12/h1-7,19H,8-9H2,(H,21,22) |
| InChIKey | RDWKRIWHLPGSEB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.75 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|