C17H16ClN3O4 — CID 1272919
N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-methoxyanilino)acetamide (PubChem CID 1272919) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-methoxyanilino)acetamide.
| Compound Name | N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 1272919 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-methoxyanilino)acetamide |
| SMILES | COc1ccccc1NCC(=O)NN=Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C17H16ClN3O4/c1-23-14-5-3-2-4-13(14)19-9-17(22)21-20-8-11-6-15-16(7-12(11)18)25-10-24-15/h2-8,19H,9-10H2,1H3,(H,21,22) |
| InChIKey | JDDKFJGEUNUUSK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|