C20H16Cl3N3O3 — CID 50930002
2-(2-methoxyanilino)-N-[(E)-[5-(2,4,5-trichlorophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 50930002) has the molecular formula C20H16Cl3N3O3 and a molecular weight of 452.73 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-N-[(E)-[5-(2,4,5-trichlorophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(2-methoxyanilino)-N-[(E)-[5-(2,4,5-trichlorophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 50930002 |
| Molecular Formula | C20H16Cl3N3O3 |
| Molecular Weight | 452.73 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | 2-(2-methoxyanilino)-N-[(E)-[5-(2,4,5-trichlorophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | COc1ccccc1NCC(=O)N/N=C/c1ccc(-c2cc(Cl)c(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C20H16Cl3N3O3/c1-28-19-5-3-2-4-17(19)24-11-20(27)26-25-10-12-6-7-18(29-12)13-8-15(22)16(23)9-14(13)21/h2-10,24H,11H2,1H3,(H,26,27)/b25-10+ |
| InChIKey | RMTBEAKHAGGMSL-KIBLKLHPSA-N |
| XLogP | 5.48 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.73 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|