C20H17Cl2N3O2 — CID 6322085
N-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-(2-methylanilino)acetamide (PubChem CID 6322085) has the molecular formula C20H17Cl2N3O2 and a molecular weight of 402.28 g/mol. Its IUPAC name is N-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-(2-methylanilino)acetamide.
| Compound Name | N-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-(2-methylanilino)acetamide |
|---|---|
| PubChem CID | 6322085 |
| Molecular Formula | C20H17Cl2N3O2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-(2-methylanilino)acetamide |
| SMILES | Cc1ccccc1NCC(=O)N/N=C/c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C20H17Cl2N3O2/c1-13-4-2-3-5-18(13)23-12-20(26)25-24-11-15-7-9-19(27-15)16-10-14(21)6-8-17(16)22/h2-11,23H,12H2,1H3,(H,25,26)/b24-11+ |
| InChIKey | JJQZCNDQYPRJDY-BHGWPJFGSA-N |
| XLogP | 5.12 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|