C19H15ClN4O4 — CID 5443599
2-anilino-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 5443599) has the molecular formula C19H15ClN4O4 and a molecular weight of 398.81 g/mol. Its IUPAC name is 2-anilino-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-anilino-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 5443599 |
| Molecular Formula | C19H15ClN4O4 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-anilino-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | O=C(CNc1ccccc1)N/N=C\c1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1 |
| InChI | InChI=1S/C19H15ClN4O4/c20-17-8-6-14(24(26)27)10-16(17)18-9-7-15(28-18)11-22-23-19(25)12-21-13-4-2-1-3-5-13/h1-11,21H,12H2,(H,23,25)/b22-11- |
| InChIKey | NBWOBFJQDAJUIX-JJFYIABZSA-N |
| XLogP | 4.07 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|