C18H10Cl3N3O4 — CID 94846692
3,4-dichloro-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]benzamide (PubChem CID 94846692) has the molecular formula C18H10Cl3N3O4 and a molecular weight of 438.65 g/mol. Its IUPAC name is 3,4-dichloro-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]benzamide.
| Compound Name | 3,4-dichloro-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 94846692 |
| Molecular Formula | C18H10Cl3N3O4 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 436.97 |
| IUPAC Name | 3,4-dichloro-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H10Cl3N3O4/c19-14-5-2-11(24(26)27)8-13(14)17-6-3-12(28-17)9-22-23-18(25)10-1-4-15(20)16(21)7-10/h1-9H,(H,23,25)/b22-9- |
| InChIKey | ZZAQFXWCEICXHA-AFPJDJCSSA-N |
| XLogP | 5.58 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|