C17H10Cl3N3O3 — CID 46495621
3,4-dichloro-N-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]aniline (PubChem CID 46495621) has the molecular formula C17H10Cl3N3O3 and a molecular weight of 410.64 g/mol. Its IUPAC name is 3,4-dichloro-N-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]aniline.
| Compound Name | 3,4-dichloro-N-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 46495621 |
| Molecular Formula | C17H10Cl3N3O3 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | 3,4-dichloro-N-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]aniline |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(-c2ccc(/C=N/Nc3ccc(Cl)c(Cl)c3)o2)c1 |
| InChI | InChI=1S/C17H10Cl3N3O3/c18-14-5-2-11(23(24)25)8-13(14)17-6-3-12(26-17)9-21-22-10-1-4-15(19)16(20)7-10/h1-9,22H/b21-9+ |
| InChIKey | CTHNGPSVVAQGBJ-ZVBGSRNCSA-N |
| XLogP | 6.26 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|