C24H14Cl2N6O8 — CID 18530001
N-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-N'-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]oxamide (PubChem CID 18530001) has the molecular formula C24H14Cl2N6O8 and a molecular weight of 585.32 g/mol. Its IUPAC name is N-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-N'-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]oxamide.
| Compound Name | N-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-N'-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 18530001 |
| Molecular Formula | C24H14Cl2N6O8 |
| Molecular Weight | 585.32 g/mol |
| Exact Mass | 584.03 |
| IUPAC Name | N-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-N'-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1)C(=O)N/N=C/c1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1 |
| InChI | InChI=1S/C24H14Cl2N6O8/c25-19-5-1-13(31(35)36)9-17(19)21-7-3-15(39-21)11-27-29-23(33)24(34)30-28-12-16-4-8-22(40-16)18-10-14(32(37)38)2-6-20(18)26/h1-12H,(H,29,33)(H,30,34)/b27-11-,28-12+ |
| InChIKey | RAZLFBVBPCQADK-FXGHDSEOSA-N |
| XLogP | 4.93 |
| TPSA | 195.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|